C25H33NO2SSi — CID 164665124
(NZ)-N-[1-[tert-butyl(dimethyl)silyl]-6-phenylhex-2-ynylidene]-4-methylbenzenesulfonamide (PubChem CID 164665124) has the molecular formula C25H33NO2SSi and a molecular weight of 439.70 g/mol. Its IUPAC name is (NZ)-N-[1-[tert-butyl(dimethyl)silyl]-6-phenylhex-2-ynylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[1-[tert-butyl(dimethyl)silyl]-6-phenylhex-2-ynylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164665124 |
| Molecular Formula | C25H33NO2SSi |
| Molecular Weight | 439.70 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (NZ)-N-[1-[tert-butyl(dimethyl)silyl]-6-phenylhex-2-ynylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/C#CCCCc2ccccc2)[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H33NO2SSi/c1-21-17-19-23(20-18-21)29(27,28)26-24(30(5,6)25(2,3)4)16-12-8-11-15-22-13-9-7-10-14-22/h7,9-10,13-14,17-20H,8,11,15H2,1-6H3/b26-24- |
| InChIKey | JDWGKAKJRUSAHI-LCUIJRPUSA-N |
| XLogP | 6.20 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|