C19H22N2O3S2 — CID 6851656
methyl N-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]-1-propan-2-ylsulfanylmethanimidate (PubChem CID 6851656) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl N-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]-1-propan-2-ylsulfanylmethanimidate.
| Compound Name | methyl N-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]-1-propan-2-ylsulfanylmethanimidate |
|---|---|
| PubChem CID | 6851656 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | methyl N-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]-1-propan-2-ylsulfanylmethanimidate |
| SMILES | CO/C(=N\C(=N\S(=O)(=O)c1ccc(C)cc1)c1ccccc1)SC(C)C |
| InChI | InChI=1S/C19H22N2O3S2/c1-14(2)25-19(24-4)20-18(16-8-6-5-7-9-16)21-26(22,23)17-12-10-15(3)11-13-17/h5-14H,1-4H3/b20-19+,21-18+ |
| InChIKey | SSZSTMXWPLUYFN-FHEVRBNFSA-N |
| XLogP | 4.27 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|