C8H6Br2ClNO3S — CID 13344625
2,2-dibromo-2-(4-chlorophenyl)sulfonylacetamide (PubChem CID 13344625) has the molecular formula C8H6Br2ClNO3S and a molecular weight of 391.47 g/mol. Its IUPAC name is 2,2-dibromo-2-(4-chlorophenyl)sulfonylacetamide.
| Compound Name | 2,2-dibromo-2-(4-chlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 13344625 |
| Molecular Formula | C8H6Br2ClNO3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 388.81 |
| IUPAC Name | 2,2-dibromo-2-(4-chlorophenyl)sulfonylacetamide |
| SMILES | NC(=O)C(Br)(Br)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6Br2ClNO3S/c9-8(10,7(12)13)16(14,15)6-3-1-5(11)2-4-6/h1-4H,(H2,12,13) |
| InChIKey | CVHLSLYVCBVXFV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|