C11H13ClO3S — CID 115048708
3-(4-chlorophenyl)sulfonyl-3-methylbutan-2-one (PubChem CID 115048708) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-3-methylbutan-2-one.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-3-methylbutan-2-one |
|---|---|
| PubChem CID | 115048708 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-3-methylbutan-2-one |
| SMILES | CC(=O)C(C)(C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClO3S/c1-8(13)11(2,3)16(14,15)10-6-4-9(12)5-7-10/h4-7H,1-3H3 |
| InChIKey | WEXVOOHLLVMIMD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |