C22H24N4O2S — CID 46256500
4-benzyl-N'-naphthalen-2-ylsulfonylpiperazine-1-carboximidamide (PubChem CID 46256500) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 4-benzyl-N'-naphthalen-2-ylsulfonylpiperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N'-naphthalen-2-ylsulfonylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 46256500 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-benzyl-N'-naphthalen-2-ylsulfonylpiperazine-1-carboximidamide |
| SMILES | N/C(=N/S(=O)(=O)c1ccc2ccccc2c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N4O2S/c23-22(26-14-12-25(13-15-26)17-18-6-2-1-3-7-18)24-29(27,28)21-11-10-19-8-4-5-9-20(19)16-21/h1-11,16H,12-15,17H2,(H2,23,24) |
| InChIKey | YHTPPDATIJHHFG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|