C20H22Cl2N6O — CID 70972589
4-benzyl-N-[2-(2,4-dichlorophenyl)ethanehydrazonoyl]iminopiperazine-1-carboxamide (PubChem CID 70972589) has the molecular formula C20H22Cl2N6O and a molecular weight of 433.34 g/mol. Its IUPAC name is 4-benzyl-N-[2-(2,4-dichlorophenyl)ethanehydrazonoyl]iminopiperazine-1-carboxamide.
| Compound Name | 4-benzyl-N-[2-(2,4-dichlorophenyl)ethanehydrazonoyl]iminopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 70972589 |
| Molecular Formula | C20H22Cl2N6O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-benzyl-N-[2-(2,4-dichlorophenyl)ethanehydrazonoyl]iminopiperazine-1-carboxamide |
| SMILES | NN=C(Cc1ccc(Cl)cc1Cl)/N=N/C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22Cl2N6O/c21-17-7-6-16(18(22)13-17)12-19(24-23)25-26-20(29)28-10-8-27(9-11-28)14-15-4-2-1-3-5-15/h1-7,13H,8-12,14,23H2/b24-19?,26-25+ |
| InChIKey | NWOJKGWFIMDIJB-DBQCWECDSA-N |
| XLogP | 4.20 |
| TPSA | 86.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|