C21H22Cl2N2O4 — CID 55475153
[2-(4-benzylpiperazin-1-yl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 55475153) has the molecular formula C21H22Cl2N2O4 and a molecular weight of 437.32 g/mol. Its IUPAC name is [2-(4-benzylpiperazin-1-yl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-(4-benzylpiperazin-1-yl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 55475153 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [2-(4-benzylpiperazin-1-yl)-2-oxoethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)OCC(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O4/c22-17-6-7-19(18(23)12-17)28-15-21(27)29-14-20(26)25-10-8-24(9-11-25)13-16-4-2-1-3-5-16/h1-7,12H,8-11,13-15H2 |
| InChIKey | KFXIRHHXZKBTCH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |