C17H13Cl2N3O — CID 56666169
1-(1-benzyltriazol-4-yl)-2-(2,4-dichlorophenyl)ethanone (PubChem CID 56666169) has the molecular formula C17H13Cl2N3O and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-(1-benzyltriazol-4-yl)-2-(2,4-dichlorophenyl)ethanone.
| Compound Name | 1-(1-benzyltriazol-4-yl)-2-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 56666169 |
| Molecular Formula | C17H13Cl2N3O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(1-benzyltriazol-4-yl)-2-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H13Cl2N3O/c18-14-7-6-13(15(19)9-14)8-17(23)16-11-22(21-20-16)10-12-4-2-1-3-5-12/h1-7,9,11H,8,10H2 |
| InChIKey | PUHFOSJGAZBWLU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |