C13H19ClN6O2 — CID 168603882
tert-butyl N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-chlorophenyl]carbamate (PubChem CID 168603882) has the molecular formula C13H19ClN6O2 and a molecular weight of 326.79 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 168603882 |
| Molecular Formula | C13H19ClN6O2 |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | tert-butyl N-[3-[[amino-(diaminomethylideneamino)methylidene]amino]-4-chlorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)c(/N=C(\N)N=C(N)N)c1 |
| InChI | InChI=1S/C13H19ClN6O2/c1-13(2,3)22-12(21)18-7-4-5-8(14)9(6-7)19-11(17)20-10(15)16/h4-6H,1-3H3,(H,18,21)(H6,15,16,17,19,20) |
| InChIKey | PVLFTEBMOAZPPG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|