C18H19N3O2 — CID 145494403
methyl 4-[[(E)-3,4-diamino-4-phenylbut-3-en-2-ylidene]amino]benzoate (PubChem CID 145494403) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 4-[[(E)-3,4-diamino-4-phenylbut-3-en-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(E)-3,4-diamino-4-phenylbut-3-en-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 145494403 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 4-[[(E)-3,4-diamino-4-phenylbut-3-en-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C(C)/C(N)=C(\N)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-12(16(19)17(20)13-6-4-3-5-7-13)21-15-10-8-14(9-11-15)18(22)23-2/h3-11H,19-20H2,1-2H3/b17-16+,21-12+ |
| InChIKey | LBRQWEHIGADKCU-YSWOWOMGSA-N |
| XLogP | 2.85 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|