C11H16N6O2 — CID 168601688
4-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-hydroxyethyl)benzamide (PubChem CID 168601688) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 4-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 168601688 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(2-hydroxyethyl)benzamide |
| SMILES | NC(N)=N/C(N)=N/c1ccc(C(=O)NCCO)cc1 |
| InChI | InChI=1S/C11H16N6O2/c12-10(13)17-11(14)16-8-3-1-7(2-4-8)9(19)15-5-6-18/h1-4,18H,5-6H2,(H,15,19)(H6,12,13,14,16,17) |
| InChIKey | XLHSJTJFJVQVAV-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|