C13H18N6O2 — CID 11971736
1-(diaminomethylidene)-2-[4-(morpholine-4-carbonyl)phenyl]guanidine (PubChem CID 11971736) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-(morpholine-4-carbonyl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-(morpholine-4-carbonyl)phenyl]guanidine |
|---|---|
| PubChem CID | 11971736 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-(morpholine-4-carbonyl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C13H18N6O2/c14-12(15)18-13(16)17-10-3-1-9(2-4-10)11(20)19-5-7-21-8-6-19/h1-4H,5-8H2,(H6,14,15,16,17,18) |
| InChIKey | RLBWSUKJWKWRGX-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|