C13H16N4O3 — CID 168533261
[[4-(morpholine-4-carbonyl)phenyl]methylideneamino]urea (PubChem CID 168533261) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is [[4-(morpholine-4-carbonyl)phenyl]methylideneamino]urea.
| Compound Name | [[4-(morpholine-4-carbonyl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533261 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [[4-(morpholine-4-carbonyl)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C13H16N4O3/c14-13(19)16-15-9-10-1-3-11(4-2-10)12(18)17-5-7-20-8-6-17/h1-4,9H,5-8H2,(H3,14,16,19) |
| InChIKey | VMMBVJWSWUWGCB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|