C15H23N5O — CID 168533510
[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methylideneamino]urea (PubChem CID 168533510) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is [[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methylideneamino]urea.
| Compound Name | [[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533510 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | [[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methylideneamino]urea |
| SMILES | CC(C)N1CCN(c2ccc(C=NNC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C15H23N5O/c1-12(2)19-7-9-20(10-8-19)14-5-3-13(4-6-14)11-17-18-15(16)21/h3-6,11-12H,7-10H2,1-2H3,(H3,16,18,21) |
| InChIKey | KTULLOIYGRQCFB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|