C15H21N3O2 — CID 6910070
ethyl N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]carbamate (PubChem CID 6910070) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 6910070 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | ethyl N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-20-15(19)17-16-12-13-6-8-14(9-7-13)18-10-4-3-5-11-18/h6-9,12H,2-5,10-11H2,1H3,(H,17,19)/b16-12+ |
| InChIKey | JSGKJBYYEFPVJI-FOWTUZBSSA-N |
| XLogP | 2.76 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|