C12H15N7O2 — CID 168605481
1-(diaminomethylidene)-2-(2,3-dimethyl-1,4-dioxophthalazin-5-yl)guanidine (PubChem CID 168605481) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2,3-dimethyl-1,4-dioxophthalazin-5-yl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(2,3-dimethyl-1,4-dioxophthalazin-5-yl)guanidine |
|---|---|
| PubChem CID | 168605481 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2,3-dimethyl-1,4-dioxophthalazin-5-yl)guanidine |
| SMILES | Cn1c(=O)c2cccc(/N=C(\N)N=C(N)N)c2c(=O)n1C |
| InChI | InChI=1S/C12H15N7O2/c1-18-9(20)6-4-3-5-7(8(6)10(21)19(18)2)16-12(15)17-11(13)14/h3-5H,1-2H3,(H6,13,14,15,16,17) |
| InChIKey | ASIJAXASKZYLJI-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|