C44H22N2O8 — CID 170848279
N-[5-[[(9,10-dioxoanthracen-2-yl)-hydroxymethylidene]amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracene-2-carboximidic acid (PubChem CID 170848279) has the molecular formula C44H22N2O8 and a molecular weight of 706.67 g/mol. Its IUPAC name is N-[5-[[(9,10-dioxoanthracen-2-yl)-hydroxymethylidene]amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracene-2-carboximidic acid.
| Compound Name | N-[5-[[(9,10-dioxoanthracen-2-yl)-hydroxymethylidene]amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracene-2-carboximidic acid |
|---|---|
| PubChem CID | 170848279 |
| Molecular Formula | C44H22N2O8 |
| Molecular Weight | 706.67 g/mol |
| Exact Mass | 706.14 |
| IUPAC Name | N-[5-[[(9,10-dioxoanthracen-2-yl)-hydroxymethylidene]amino]-9,10-dioxoanthracen-1-yl]-9,10-dioxoanthracene-2-carboximidic acid |
| SMILES | O=C1c2ccccc2C(=O)c2cc(/C(O)=N/c3cccc4c3C(=O)c3cccc(/N=C(\O)c5ccc6c(c5)C(=O)c5ccccc5C6=O)c3C4=O)ccc21 |
| InChI | InChI=1S/C44H22N2O8/c47-37-23-7-1-3-9-25(23)39(49)31-19-21(15-17-27(31)37)43(53)45-33-13-5-11-29-35(33)41(51)30-12-6-14-34(36(30)42(29)52)46-44(54)22-16-18-28-32(20-22)40(50)26-10-4-2-8-24(26)38(28)48/h1-20H,(H,45,53)(H,46,54) |
| InChIKey | CPHONHMAELUPOP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 167.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.67 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|