C50H36N2O2P2 — CID 15579044
1,5-bis[(triphenyl-λ5-phosphanylidene)amino]anthracene-9,10-dione (PubChem CID 15579044) has the molecular formula C50H36N2O2P2 and a molecular weight of 758.80 g/mol. Its IUPAC name is 1,5-bis[(triphenyl-λ5-phosphanylidene)amino]anthracene-9,10-dione.
| Compound Name | 1,5-bis[(triphenyl-λ5-phosphanylidene)amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 15579044 |
| Molecular Formula | C50H36N2O2P2 |
| Molecular Weight | 758.80 g/mol |
| Exact Mass | 758.23 |
| IUPAC Name | 1,5-bis[(triphenyl-λ5-phosphanylidene)amino]anthracene-9,10-dione |
| SMILES | O=C1c2cccc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)c2C(=O)c2cccc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)c21 |
| InChI | InChI=1S/C50H36N2O2P2/c53-49-44-34-20-36-46(52-56(40-27-13-4-14-28-40,41-29-15-5-16-30-41)42-31-17-6-18-32-42)48(44)50(54)43-33-19-35-45(47(43)49)51-55(37-21-7-1-8-22-37,38-23-9-2-10-24-38)39-25-11-3-12-26-39/h1-36H |
| InChIKey | NIDJLGFOKVAHDJ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.80 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|