C50H40N2OP2 — CID 10556984
triphenyl-[2-[(2R,3S)-3-[2-[(triphenyl-lambda5-phosphanylidene)amino]phenyl]oxiran-2-yl]phenyl]imino-lambda5-phosphane (PubChem CID 10556984) has the molecular formula C50H40N2OP2 and a molecular weight of 746.83 g/mol. Its IUPAC name is triphenyl-[2-[(2R,3S)-3-[2-[(triphenyl-lambda5-phosphanylidene)amino]phenyl]oxiran-2-yl]phenyl]imino-lambda5-phosphane.
| Compound Name | triphenyl-[2-[(2R,3S)-3-[2-[(triphenyl-lambda5-phosphanylidene)amino]phenyl]oxiran-2-yl]phenyl]imino-lambda5-phosphane |
|---|---|
| PubChem CID | 10556984 |
| Molecular Formula | C50H40N2OP2 |
| Molecular Weight | 746.83 g/mol |
| Exact Mass | 746.26 |
| IUPAC Name | triphenyl-[2-[(2R,3S)-3-[2-[(triphenyl-lambda5-phosphanylidene)amino]phenyl]oxiran-2-yl]phenyl]imino-lambda5-phosphane |
| SMILES | c1ccc(P(=Nc2ccccc2[C@H]2O[C@H]2c2ccccc2N=P(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H40N2OP2/c1-7-23-39(24-8-1)54(40-25-9-2-10-26-40,41-27-11-3-12-28-41)51-47-37-21-19-35-45(47)49-50(53-49)46-36-20-22-38-48(46)52-55(42-29-13-4-14-30-42,43-31-15-5-16-32-43)44-33-17-6-18-34-44/h1-38,49-50H/t49-,50+ |
| InChIKey | QLHPLWHLAWYLTN-DKSDCYBHSA-N |
| XLogP | 11.12 |
| TPSA | 37.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.83 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|