C15H10N2O2 — CID 58592242
1-(methyldiazenyl)anthracene-9,10-dione (PubChem CID 58592242) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-(methyldiazenyl)anthracene-9,10-dione.
| Compound Name | 1-(methyldiazenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 58592242 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-(methyldiazenyl)anthracene-9,10-dione |
| SMILES | C/N=N/c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H10N2O2/c1-16-17-12-8-4-7-11-13(12)15(19)10-6-3-2-5-9(10)14(11)18/h2-8H,1H3/b17-16+ |
| InChIKey | RSLCGKLCTGAECR-WUKNDPDISA-N |
| XLogP | 3.18 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|