C18H14N2O4 — CID 2974413
[4-[2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethenyl]phenyl] acetate (PubChem CID 2974413) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is [4-[2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethenyl]phenyl] acetate.
| Compound Name | [4-[2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 2974413 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [4-[2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=Cc2noc(-c3ccccc3O)n2)cc1 |
| InChI | InChI=1S/C18H14N2O4/c1-12(21)23-14-9-6-13(7-10-14)8-11-17-19-18(24-20-17)15-4-2-3-5-16(15)22/h2-11,22H,1H3 |
| InChIKey | PWVKWZXUXBPYQQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|