C17H14N2O5 — CID 164843748
[5-(hydroxymethyl)-2-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate (PubChem CID 164843748) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate.
| Compound Name | [5-(hydroxymethyl)-2-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 164843748 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [5-(hydroxymethyl)-2-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(CO)ccc1-c1nc(-c2ccccc2O)no1 |
| InChI | InChI=1S/C17H14N2O5/c1-10(21)23-15-8-11(9-20)6-7-13(15)17-18-16(19-24-17)12-4-2-3-5-14(12)22/h2-8,20,22H,9H2,1H3 |
| InChIKey | MSWKRBXUPRDSOI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|