C9H8N2O3 — CID 137002934
2-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 137002934) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 2-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 137002934 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | OCc1nc(-c2ccccc2O)no1 |
| InChI | InChI=1S/C9H8N2O3/c12-5-8-10-9(11-14-8)6-3-1-2-4-7(6)13/h1-4,12-13H,5H2 |
| InChIKey | GEHXHFNOEITFKR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |