C7H5ClN2O3 — CID 115079991
[3-(5-chlorofuran-2-yl)-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 115079991) has the molecular formula C7H5ClN2O3 and a molecular weight of 200.58 g/mol. Its IUPAC name is [3-(5-chlorofuran-2-yl)-1,2,4-oxadiazol-5-yl]methanol.
| Compound Name | [3-(5-chlorofuran-2-yl)-1,2,4-oxadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 115079991 |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | [3-(5-chlorofuran-2-yl)-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | OCc1nc(-c2ccc(Cl)o2)no1 |
| InChI | InChI=1S/C7H5ClN2O3/c8-5-2-1-4(12-5)7-9-6(3-11)13-10-7/h1-2,11H,3H2 |
| InChIKey | ZSUHOLILCNNZQK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |