C9H10N2O3S — CID 142472649
[3-(3-ethoxythiophen-2-yl)-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 142472649) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is [3-(3-ethoxythiophen-2-yl)-1,2,4-oxadiazol-5-yl]methanol.
| Compound Name | [3-(3-ethoxythiophen-2-yl)-1,2,4-oxadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 142472649 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | [3-(3-ethoxythiophen-2-yl)-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | CCOc1ccsc1-c1noc(CO)n1 |
| InChI | InChI=1S/C9H10N2O3S/c1-2-13-6-3-4-15-8(6)9-10-7(5-12)14-11-9/h3-4,12H,2,5H2,1H3 |
| InChIKey | RSMVLOPWCRDIGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |