C16H16N4O2S2 — CID 100761182
1-(2-ethoxyphenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea (PubChem CID 100761182) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100761182 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea |
| SMILES | CCOc1ccccc1NC(=S)NCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C16H16N4O2S2/c1-2-21-12-7-4-3-6-11(12)18-16(23)17-10-14-19-15(20-22-14)13-8-5-9-24-13/h3-9H,2,10H2,1H3,(H2,17,18,23) |
| InChIKey | JZVLWQTZHDRGLD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|