C14H11BrN4OS2 — CID 100761175
1-(4-bromophenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea (PubChem CID 100761175) has the molecular formula C14H11BrN4OS2 and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100761175 |
| Molecular Formula | C14H11BrN4OS2 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]thiourea |
| SMILES | S=C(NCc1nc(-c2cccs2)no1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H11BrN4OS2/c15-9-3-5-10(6-4-9)17-14(21)16-8-12-18-13(19-20-12)11-2-1-7-22-11/h1-7H,8H2,(H2,16,17,21) |
| InChIKey | CCLCWPTZPYWHLH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|