C17H16N4O3S2 — CID 100761274
methyl 2-methyl-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methylcarbamothioylamino]benzoate (PubChem CID 100761274) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl 2-methyl-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methylcarbamothioylamino]benzoate.
| Compound Name | methyl 2-methyl-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100761274 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | methyl 2-methyl-3-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NCc2nc(-c3cccs3)no2)c1C |
| InChI | InChI=1S/C17H16N4O3S2/c1-10-11(16(22)23-2)5-3-6-12(10)19-17(25)18-9-14-20-15(21-24-14)13-7-4-8-26-13/h3-8H,9H2,1-2H3,(H2,18,19,25) |
| InChIKey | UNMFSCPPQIKJSA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|