C10H18N4OS — CID 142472775
5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen;propane (PubChem CID 142472775) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen;propane.
| Compound Name | 5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen;propane |
|---|---|
| PubChem CID | 142472775 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen;propane |
| SMILES | CCC.CCOc1ccsc1-c1nn[nH]n1.[H][H] |
| InChI | InChI=1S/C7H8N4OS.C3H8.H2/c1-2-12-5-3-4-13-6(5)7-8-10-11-9-7;1-3-2;/h3-4H,2H2,1H3,(H,8,9,10,11);3H2,1-2H3;1H |
| InChIKey | QNGLPDUJENGBMA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |