C18H20O3S3 — CID 139212118
3-ethoxy-5-(3-ethoxythiophen-2-yl)-2-(4-ethoxythiophen-2-yl)thiophene (PubChem CID 139212118) has the molecular formula C18H20O3S3 and a molecular weight of 380.56 g/mol. Its IUPAC name is 3-ethoxy-5-(3-ethoxythiophen-2-yl)-2-(4-ethoxythiophen-2-yl)thiophene.
| Compound Name | 3-ethoxy-5-(3-ethoxythiophen-2-yl)-2-(4-ethoxythiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 139212118 |
| Molecular Formula | C18H20O3S3 |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3-ethoxy-5-(3-ethoxythiophen-2-yl)-2-(4-ethoxythiophen-2-yl)thiophene |
| SMILES | CCOc1csc(-c2sc(-c3sccc3OCC)cc2OCC)c1 |
| InChI | InChI=1S/C18H20O3S3/c1-4-19-12-9-15(23-11-12)18-14(21-6-3)10-16(24-18)17-13(20-5-2)7-8-22-17/h7-11H,4-6H2,1-3H3 |
| InChIKey | ZJIDRDNFPZGHRB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |