C9H16N4OS — CID 142472719
ethane;5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen (PubChem CID 142472719) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is ethane;5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen.
| Compound Name | ethane;5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen |
|---|---|
| PubChem CID | 142472719 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | ethane;5-(3-ethoxythiophen-2-yl)-2H-tetrazole;molecular hydrogen |
| SMILES | CC.CCOc1ccsc1-c1nn[nH]n1.[H][H] |
| InChI | InChI=1S/C7H8N4OS.C2H6.H2/c1-2-12-5-3-4-13-6(5)7-8-10-11-9-7;1-2;/h3-4H,2H2,1H3,(H,8,9,10,11);1-2H3;1H |
| InChIKey | OKNUUEFEFYFUGX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |