C12H20N4 — CID 145087204
ethane;molecular hydrogen;5-(4-propan-2-ylphenyl)-2H-tetrazole (PubChem CID 145087204) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is ethane;molecular hydrogen;5-(4-propan-2-ylphenyl)-2H-tetrazole.
| Compound Name | ethane;molecular hydrogen;5-(4-propan-2-ylphenyl)-2H-tetrazole |
|---|---|
| PubChem CID | 145087204 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | ethane;molecular hydrogen;5-(4-propan-2-ylphenyl)-2H-tetrazole |
| SMILES | CC.CC(C)c1ccc(-c2nn[nH]n2)cc1.[H][H] |
| InChI | InChI=1S/C10H12N4.C2H6.H2/c1-7(2)8-3-5-9(6-4-8)10-11-13-14-12-10;1-2;/h3-7H,1-2H3,(H,11,12,13,14);1-2H3;1H |
| InChIKey | MCKKAGDHUHZXPH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |