C7H6N4OPb — CID 175020702
CID 175020702 (PubChem CID 175020702) has the molecular formula C7H6N4OPb and a molecular weight of 369.35 g/mol.
| Compound Name | CID 175020702 |
|---|---|
| PubChem CID | 175020702 |
| Molecular Formula | C7H6N4OPb |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | — |
| SMILES | Oc1ccc(-c2nn[nH]n2)cc1.[Pb] |
| InChI | InChI=1S/C7H6N4O.Pb/c12-6-3-1-5(2-4-6)7-8-10-11-9-7;/h1-4,12H,(H,8,9,10,11); |
| InChIKey | HUNAPWGCKUJWRN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |