C19H13FN4O2 — CID 136929552
4-(4-fluorophenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,2-diol (PubChem CID 136929552) has the molecular formula C19H13FN4O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,2-diol.
| Compound Name | 4-(4-fluorophenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136929552 |
| Molecular Formula | C19H13FN4O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(4-fluorophenyl)-5-[4-(2H-tetrazol-5-yl)phenyl]benzene-1,2-diol |
| SMILES | Oc1cc(-c2ccc(F)cc2)c(-c2ccc(-c3nn[nH]n3)cc2)cc1O |
| InChI | InChI=1S/C19H13FN4O2/c20-14-7-5-12(6-8-14)16-10-18(26)17(25)9-15(16)11-1-3-13(4-2-11)19-21-23-24-22-19/h1-10,25-26H,(H,21,22,23,24) |
| InChIKey | OMZZHXVCRSCVDU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|