C28H30O4S5 — CID 163890490
2,3,4,5-tetrakis(3-ethoxythiophen-2-yl)-2,3-dihydrothiophene (PubChem CID 163890490) has the molecular formula C28H30O4S5 and a molecular weight of 590.88 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(3-ethoxythiophen-2-yl)-2,3-dihydrothiophene.
| Compound Name | 2,3,4,5-tetrakis(3-ethoxythiophen-2-yl)-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 163890490 |
| Molecular Formula | C28H30O4S5 |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 2,3,4,5-tetrakis(3-ethoxythiophen-2-yl)-2,3-dihydrothiophene |
| SMILES | CCOc1ccsc1C1=C(c2sccc2OCC)C(c2sccc2OCC)C(c2sccc2OCC)S1 |
| InChI | InChI=1S/C28H30O4S5/c1-5-29-17-9-13-33-23(17)21-22(24-18(30-6-2)10-14-34-24)28(26-20(32-8-4)12-16-36-26)37-27(21)25-19(31-7-3)11-15-35-25/h9-16,21,27H,5-8H2,1-4H3 |
| InChIKey | QBCJUGGKSBFAFG-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |