C11H9F7O — CID 139967229
1-ethoxy-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 139967229) has the molecular formula C11H9F7O and a molecular weight of 290.18 g/mol. Its IUPAC name is 1-ethoxy-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1-ethoxy-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 139967229 |
| Molecular Formula | C11H9F7O |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-ethoxy-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | CCOc1ccccc1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F7O/c1-2-19-8-6-4-3-5-7(8)9(12,10(13,14)15)11(16,17)18/h3-6H,2H2,1H3 |
| InChIKey | GOHBJEIYQGYHFB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |