C7H6N4O2 — CID 63758301
(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanol (PubChem CID 63758301) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is (3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanol.
| Compound Name | (3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 63758301 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanol |
| SMILES | OCc1nc(-c2cnccn2)no1 |
| InChI | InChI=1S/C7H6N4O2/c12-4-6-10-7(11-13-6)5-3-8-1-2-9-5/h1-3,12H,4H2 |
| InChIKey | FDFYGOHTSPNQER-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |