C13H10N4O2 — CID 63845058
3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenol (PubChem CID 63845058) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenol.
| Compound Name | 3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenol |
|---|---|
| PubChem CID | 63845058 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-[(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenol |
| SMILES | Oc1cccc(Cc2nc(-c3cnccn3)no2)c1 |
| InChI | InChI=1S/C13H10N4O2/c18-10-3-1-2-9(6-10)7-12-16-13(17-19-12)11-8-14-4-5-15-11/h1-6,8,18H,7H2 |
| InChIKey | PXZPAFWJHZVGQV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |