C16H13BrN2O2 — CID 103084122
3-[[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol (PubChem CID 103084122) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 3-[[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol.
| Compound Name | 3-[[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 103084122 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-[[3-(4-bromo-2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
| SMILES | Cc1cc(Br)ccc1-c1noc(Cc2cccc(O)c2)n1 |
| InChI | InChI=1S/C16H13BrN2O2/c1-10-7-12(17)5-6-14(10)16-18-15(21-19-16)9-11-3-2-4-13(20)8-11/h2-8,20H,9H2,1H3 |
| InChIKey | HZXBAQHGAHNUGN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |