C11H13N3O2 — CID 115078870
3-[[3-(2-aminoethyl)-1,2,4-oxadiazol-5-yl]methyl]phenol (PubChem CID 115078870) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-[[3-(2-aminoethyl)-1,2,4-oxadiazol-5-yl]methyl]phenol.
| Compound Name | 3-[[3-(2-aminoethyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 115078870 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-[[3-(2-aminoethyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
| SMILES | NCCc1noc(Cc2cccc(O)c2)n1 |
| InChI | InChI=1S/C11H13N3O2/c12-5-4-10-13-11(16-14-10)7-8-2-1-3-9(15)6-8/h1-3,6,15H,4-5,7,12H2 |
| InChIKey | KRUCGCCWRFUJIQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |