C14H16N2O3 — CID 65334211
3-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol (PubChem CID 65334211) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol.
| Compound Name | 3-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 65334211 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-[[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
| SMILES | Oc1cccc(Cc2nc(C3CCOCC3)no2)c1 |
| InChI | InChI=1S/C14H16N2O3/c17-12-3-1-2-10(8-12)9-13-15-14(16-19-13)11-4-6-18-7-5-11/h1-3,8,11,17H,4-7,9H2 |
| InChIKey | GZUCZHLRUHXGRQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |