C15H16N2O3 — CID 65334732
2-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone (PubChem CID 65334732) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone.
| Compound Name | 2-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 65334732 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone |
| SMILES | O=C(Cc1nc(C2CCOCC2)no1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O3/c18-13(11-4-2-1-3-5-11)10-14-16-15(17-20-14)12-6-8-19-9-7-12/h1-5,12H,6-10H2 |
| InChIKey | IWBLBRMDPDLPAV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |