C16H11ClN2O2 — CID 63345476
2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone (PubChem CID 63345476) has the molecular formula C16H11ClN2O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone.
| Compound Name | 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 63345476 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2Cl)no1)c1ccccc1 |
| InChI | InChI=1S/C16H11ClN2O2/c17-13-9-5-4-8-12(13)16-18-15(21-19-16)10-14(20)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | CZHUZJJLCKKGPI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |