C13H14N2O3 — CID 65329458
3-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol (PubChem CID 65329458) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol.
| Compound Name | 3-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 65329458 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
| SMILES | Oc1cccc(Cc2nc(C3CCOC3)no2)c1 |
| InChI | InChI=1S/C13H14N2O3/c16-11-3-1-2-9(6-11)7-12-14-13(15-18-12)10-4-5-17-8-10/h1-3,6,10,16H,4-5,7-8H2 |
| InChIKey | ZUEIXKLMSMLLOI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |