C13H15N3O3 — CID 65329992
4-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methylamino]phenol (PubChem CID 65329992) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methylamino]phenol.
| Compound Name | 4-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methylamino]phenol |
|---|---|
| PubChem CID | 65329992 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-[[3-(oxolan-3-yl)-1,2,4-oxadiazol-5-yl]methylamino]phenol |
| SMILES | Oc1ccc(NCc2nc(C3CCOC3)no2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c17-11-3-1-10(2-4-11)14-7-12-15-13(16-19-12)9-5-6-18-8-9/h1-4,9,14,17H,5-8H2 |
| InChIKey | AKFVBVCPVZJLNL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|