C14H16N2O3 — CID 97444140
4-[2-[3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]ethyl]phenol (PubChem CID 97444140) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[2-[3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]ethyl]phenol.
| Compound Name | 4-[2-[3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]ethyl]phenol |
|---|---|
| PubChem CID | 97444140 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-[2-[3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazol-5-yl]ethyl]phenol |
| SMILES | Oc1ccc(CCc2nc([C@H]3CCOC3)no2)cc1 |
| InChI | InChI=1S/C14H16N2O3/c17-12-4-1-10(2-5-12)3-6-13-15-14(16-19-13)11-7-8-18-9-11/h1-2,4-5,11,17H,3,6-9H2/t11-/m0/s1 |
| InChIKey | OMWOKFLTTAAMDN-NSHDSACASA-N |
| XLogP | 2.06 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |