C12H8ClN5O — CID 178100910
5-(chloromethyl)-3-(6-pyrazin-2-yl-2-pyridinyl)-1,2,4-oxadiazole (PubChem CID 178100910) has the molecular formula C12H8ClN5O and a molecular weight of 273.68 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(6-pyrazin-2-yl-2-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-(6-pyrazin-2-yl-2-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 178100910 |
| Molecular Formula | C12H8ClN5O |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 5-(chloromethyl)-3-(6-pyrazin-2-yl-2-pyridinyl)-1,2,4-oxadiazole |
| SMILES | ClCc1nc(-c2cccc(-c3cnccn3)n2)no1 |
| InChI | InChI=1S/C12H8ClN5O/c13-6-11-17-12(18-19-11)9-3-1-2-8(16-9)10-7-14-4-5-15-10/h1-5,7H,6H2 |
| InChIKey | JXRIJAQZIHXWAT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|