About iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine
iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine (PubChem CID 175253430) has the molecular formula C13H9FeN5
and a molecular weight of 291.10 g/mol. Its IUPAC name is iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine.
Molecular Properties
| Compound Name | iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine |
| PubChem CID | 175253430 |
| Molecular Formula | C13H9FeN5 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine |
| SMILES | [Fe].c1cc(-c2cnccn2)nc(-c2cnccn2)c1 |
| InChI | InChI=1S/C13H9N5.Fe/c1-2-10(12-8-14-4-6-16-12)18-11(3-1)13-9-15-5-7-17-13;/h1-9H; |
| InChIKey | AHZZBXPIMPUOLU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine?
The IUPAC name of iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine (CID 175253430) is iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine.
What is the SMILES notation for iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine?
The canonical SMILES for iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine is [Fe].c1cc(-c2cnccn2)nc(-c2cnccn2)c1.
What is the InChIKey of iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine?
The InChIKey is AHZZBXPIMPUOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5.Fe/c1-2-10(12-8-14-4-6-16-12)18-11(3-1)13-9-15-5-7-17-13;/h1-9H;.
What are the key properties of iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine?
iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine has a molecular weight of 291.10 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2-(6-pyrazin-2-yl-2-pyridinyl)pyrazine is sourced from PubChem (CID 175253430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).