About 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole
5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole (PubChem CID 97057636) has the molecular formula C9H5ClF2N2O
and a molecular weight of 230.60 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole |
| PubChem CID | 97057636 |
| Molecular Formula | C9H5ClF2N2O |
| Molecular Weight | 230.60 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1cccc(F)c1-c1noc(CCl)n1 |
| InChI | InChI=1S/C9H5ClF2N2O/c10-4-7-13-9(14-15-7)8-5(11)2-1-3-6(8)12/h1-3H,4H2 |
| InChIKey | AKGGCGCKEICBGM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole?
The IUPAC name of 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole (CID 97057636) is 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole is Fc1cccc(F)c1-c1noc(CCl)n1.
What is the InChIKey of 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole?
The InChIKey is AKGGCGCKEICBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClF2N2O/c10-4-7-13-9(14-15-7)8-5(11)2-1-3-6(8)12/h1-3H,4H2.
What are the key properties of 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole?
5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole has a molecular weight of 230.60 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3-(2,6-difluorophenyl)-1,2,4-oxadiazole is sourced from PubChem (CID 97057636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).