C9H10ClN3O — CID 91811897
5-(chloromethyl)-3-(1-ethylpyrrol-2-yl)-1,2,4-oxadiazole (PubChem CID 91811897) has the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(1-ethylpyrrol-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-(1-ethylpyrrol-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91811897 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 5-(chloromethyl)-3-(1-ethylpyrrol-2-yl)-1,2,4-oxadiazole |
| SMILES | CCn1cccc1-c1noc(CCl)n1 |
| InChI | InChI=1S/C9H10ClN3O/c1-2-13-5-3-4-7(13)9-11-8(6-10)14-12-9/h3-5H,2,6H2,1H3 |
| InChIKey | NEJPPAQVGJULJJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|